C16H20N4O3 — CID 972049
ethyl 4-[(1,3,5-trimethylpyrazol-4-yl)carbamoylamino]benzoate (PubChem CID 972049) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is ethyl 4-[(1,3,5-trimethylpyrazol-4-yl)carbamoylamino]benzoate.
| Compound Name | ethyl 4-[(1,3,5-trimethylpyrazol-4-yl)carbamoylamino]benzoate |
|---|---|
| PubChem CID | 972049 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | ethyl 4-[(1,3,5-trimethylpyrazol-4-yl)carbamoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Nc2c(C)nn(C)c2C)cc1 |
| InChI | InChI=1S/C16H20N4O3/c1-5-23-15(21)12-6-8-13(9-7-12)17-16(22)18-14-10(2)19-20(4)11(14)3/h6-9H,5H2,1-4H3,(H2,17,18,22) |
| InChIKey | CEYZPCRTWDRGKX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |