C16H20FN3O — CID 97205777
1-[(2S)-2-(dimethylamino)-2-(3-fluorophenyl)acetyl]piperidine-4-carbonitrile (PubChem CID 97205777) has the molecular formula C16H20FN3O and a molecular weight of 289.35 g/mol. Its IUPAC name is 1-[(2S)-2-(dimethylamino)-2-(3-fluorophenyl)acetyl]piperidine-4-carbonitrile.
| Compound Name | 1-[(2S)-2-(dimethylamino)-2-(3-fluorophenyl)acetyl]piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 97205777 |
| Molecular Formula | C16H20FN3O |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 1-[(2S)-2-(dimethylamino)-2-(3-fluorophenyl)acetyl]piperidine-4-carbonitrile |
| SMILES | CN(C)[C@H](C(=O)N1CCC(C#N)CC1)c1cccc(F)c1 |
| InChI | InChI=1S/C16H20FN3O/c1-19(2)15(13-4-3-5-14(17)10-13)16(21)20-8-6-12(11-18)7-9-20/h3-5,10,12,15H,6-9H2,1-2H3/t15-/m0/s1 |
| InChIKey | JGZQWECNWJPIKX-HNNXBMFYSA-N |
| XLogP | 2.19 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |