C19H24N4O3 — CID 97206029
methyl (2S)-2-[methyl-[(1-phenylpyrazol-4-yl)methyl]carbamoyl]piperidine-1-carboxylate (PubChem CID 97206029) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is methyl (2S)-2-[methyl-[(1-phenylpyrazol-4-yl)methyl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | methyl (2S)-2-[methyl-[(1-phenylpyrazol-4-yl)methyl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97206029 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | methyl (2S)-2-[methyl-[(1-phenylpyrazol-4-yl)methyl]carbamoyl]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCCC[C@H]1C(=O)N(C)Cc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C19H24N4O3/c1-21(18(24)17-10-6-7-11-22(17)19(25)26-2)13-15-12-20-23(14-15)16-8-4-3-5-9-16/h3-5,8-9,12,14,17H,6-7,10-11,13H2,1-2H3/t17-/m0/s1 |
| InChIKey | KJBCDSJXZRMSDK-KRWDZBQOSA-N |
| XLogP | 2.45 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |