C14H20F2N4O2 — CID 97206852
N-[2-[(2R)-1-[1-(difluoromethyl)pyrazole-3-carbonyl]piperidin-2-yl]ethyl]acetamide (PubChem CID 97206852) has the molecular formula C14H20F2N4O2 and a molecular weight of 314.34 g/mol. Its IUPAC name is N-[2-[(2R)-1-[1-(difluoromethyl)pyrazole-3-carbonyl]piperidin-2-yl]ethyl]acetamide.
| Compound Name | N-[2-[(2R)-1-[1-(difluoromethyl)pyrazole-3-carbonyl]piperidin-2-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 97206852 |
| Molecular Formula | C14H20F2N4O2 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | N-[2-[(2R)-1-[1-(difluoromethyl)pyrazole-3-carbonyl]piperidin-2-yl]ethyl]acetamide |
| SMILES | CC(=O)NCC[C@H]1CCCCN1C(=O)c1ccn(C(F)F)n1 |
| InChI | InChI=1S/C14H20F2N4O2/c1-10(21)17-7-5-11-4-2-3-8-19(11)13(22)12-6-9-20(18-12)14(15)16/h6,9,11,14H,2-5,7-8H2,1H3,(H,17,21)/t11-/m1/s1 |
| InChIKey | VXHSXUMQGHWBFW-LLVKDONJSA-N |
| XLogP | 1.80 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |