C22H24N2O3 — CID 97207184
(3R)-8-(3-methoxybenzoyl)-3-phenyl-1,8-diazaspiro[4.5]decan-2-one (PubChem CID 97207184) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is (3R)-8-(3-methoxybenzoyl)-3-phenyl-1,8-diazaspiro[4.5]decan-2-one.
| Compound Name | (3R)-8-(3-methoxybenzoyl)-3-phenyl-1,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 97207184 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (3R)-8-(3-methoxybenzoyl)-3-phenyl-1,8-diazaspiro[4.5]decan-2-one |
| SMILES | COc1cccc(C(=O)N2CCC3(CC2)C[C@H](c2ccccc2)C(=O)N3)c1 |
| InChI | InChI=1S/C22H24N2O3/c1-27-18-9-5-8-17(14-18)21(26)24-12-10-22(11-13-24)15-19(20(25)23-22)16-6-3-2-4-7-16/h2-9,14,19H,10-13,15H2,1H3,(H,23,25)/t19-/m1/s1 |
| InChIKey | JJPDYTOKQPOTTO-LJQANCHMSA-N |
| XLogP | 2.97 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |