C17H26N2O4 — CID 97207749
(2R)-2-(3-ethoxyphenyl)-2-[methyl(2-morpholin-4-ylethyl)amino]acetic acid (PubChem CID 97207749) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is (2R)-2-(3-ethoxyphenyl)-2-[methyl(2-morpholin-4-ylethyl)amino]acetic acid.
| Compound Name | (2R)-2-(3-ethoxyphenyl)-2-[methyl(2-morpholin-4-ylethyl)amino]acetic acid |
|---|---|
| PubChem CID | 97207749 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | (2R)-2-(3-ethoxyphenyl)-2-[methyl(2-morpholin-4-ylethyl)amino]acetic acid |
| SMILES | CCOc1cccc([C@H](C(=O)O)N(C)CCN2CCOCC2)c1 |
| InChI | InChI=1S/C17H26N2O4/c1-3-23-15-6-4-5-14(13-15)16(17(20)21)18(2)7-8-19-9-11-22-12-10-19/h4-6,13,16H,3,7-12H2,1-2H3,(H,20,21)/t16-/m1/s1 |
| InChIKey | CJBIFFDVTHOJPU-MRXNPFEDSA-N |
| XLogP | 1.48 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |