C19H26N2O4S — CID 97208205
3-(cyclohexen-1-ylmethylsulfamoyl)-N-[[(2S)-oxolan-2-yl]methyl]benzamide (PubChem CID 97208205) has the molecular formula C19H26N2O4S and a molecular weight of 378.49 g/mol. Its IUPAC name is 3-(cyclohexen-1-ylmethylsulfamoyl)-N-[[(2S)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 3-(cyclohexen-1-ylmethylsulfamoyl)-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 97208205 |
| Molecular Formula | C19H26N2O4S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 3-(cyclohexen-1-ylmethylsulfamoyl)-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
| SMILES | O=C(NC[C@@H]1CCCO1)c1cccc(S(=O)(=O)NCC2=CCCCC2)c1 |
| InChI | InChI=1S/C19H26N2O4S/c22-19(20-14-17-9-5-11-25-17)16-8-4-10-18(12-16)26(23,24)21-13-15-6-2-1-3-7-15/h4,6,8,10,12,17,21H,1-3,5,7,9,11,13-14H2,(H,20,22)/t17-/m0/s1 |
| InChIKey | HCGQUYKMSHJZTJ-KRWDZBQOSA-N |
| XLogP | 2.37 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|