C18H30N4O — CID 97209190
(2R)-N-[[2-[ethyl(methyl)amino]phenyl]methyl]-2-(4-methylpiperazin-1-yl)propanamide (PubChem CID 97209190) has the molecular formula C18H30N4O and a molecular weight of 318.47 g/mol. Its IUPAC name is (2R)-N-[[2-[ethyl(methyl)amino]phenyl]methyl]-2-(4-methylpiperazin-1-yl)propanamide.
| Compound Name | (2R)-N-[[2-[ethyl(methyl)amino]phenyl]methyl]-2-(4-methylpiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 97209190 |
| Molecular Formula | C18H30N4O |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | (2R)-N-[[2-[ethyl(methyl)amino]phenyl]methyl]-2-(4-methylpiperazin-1-yl)propanamide |
| SMILES | CCN(C)c1ccccc1CNC(=O)[C@@H](C)N1CCN(C)CC1 |
| InChI | InChI=1S/C18H30N4O/c1-5-21(4)17-9-7-6-8-16(17)14-19-18(23)15(2)22-12-10-20(3)11-13-22/h6-9,15H,5,10-14H2,1-4H3,(H,19,23)/t15-/m1/s1 |
| InChIKey | CCCRNXFDWVUMRV-OAHLLOKOSA-N |
| XLogP | 1.39 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |