C19H25N3O2S — CID 97210944
N-(2-methyl-1,3-benzothiazol-6-yl)-2-oxo-2-[(4S)-4-propylazepan-1-yl]acetamide (PubChem CID 97210944) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is N-(2-methyl-1,3-benzothiazol-6-yl)-2-oxo-2-[(4S)-4-propylazepan-1-yl]acetamide.
| Compound Name | N-(2-methyl-1,3-benzothiazol-6-yl)-2-oxo-2-[(4S)-4-propylazepan-1-yl]acetamide |
|---|---|
| PubChem CID | 97210944 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | N-(2-methyl-1,3-benzothiazol-6-yl)-2-oxo-2-[(4S)-4-propylazepan-1-yl]acetamide |
| SMILES | CCC[C@H]1CCCN(C(=O)C(=O)Nc2ccc3nc(C)sc3c2)CC1 |
| InChI | InChI=1S/C19H25N3O2S/c1-3-5-14-6-4-10-22(11-9-14)19(24)18(23)21-15-7-8-16-17(12-15)25-13(2)20-16/h7-8,12,14H,3-6,9-11H2,1-2H3,(H,21,23)/t14-/m0/s1 |
| InChIKey | DCRNGMWMYHIYEZ-AWEZNQCLSA-N |
| XLogP | 3.97 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|