C12H18N2O4 — CID 97211103
(2S)-2-[2-methoxyethyl(methyl)amino]-2-(6-methoxy-3-pyridinyl)acetic acid (PubChem CID 97211103) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is (2S)-2-[2-methoxyethyl(methyl)amino]-2-(6-methoxy-3-pyridinyl)acetic acid.
| Compound Name | (2S)-2-[2-methoxyethyl(methyl)amino]-2-(6-methoxy-3-pyridinyl)acetic acid |
|---|---|
| PubChem CID | 97211103 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (2S)-2-[2-methoxyethyl(methyl)amino]-2-(6-methoxy-3-pyridinyl)acetic acid |
| SMILES | COCCN(C)[C@H](C(=O)O)c1ccc(OC)nc1 |
| InChI | InChI=1S/C12H18N2O4/c1-14(6-7-17-2)11(12(15)16)9-4-5-10(18-3)13-8-9/h4-5,8,11H,6-7H2,1-3H3,(H,15,16)/t11-/m0/s1 |
| InChIKey | ONIKKYSBCRENAP-NSHDSACASA-N |
| XLogP | 0.79 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |