About (2S)-2-thiophen-2-yl-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one
(2S)-2-thiophen-2-yl-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one (PubChem CID 97211396) has the molecular formula C11H9N3OS
and a molecular weight of 231.28 g/mol. Its IUPAC name is (2S)-2-thiophen-2-yl-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | (2S)-2-thiophen-2-yl-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one |
| PubChem CID | 97211396 |
| Molecular Formula | C11H9N3OS |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | (2S)-2-thiophen-2-yl-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one |
| SMILES | O=C1N[C@@H](c2cccs2)Nc2ncccc21 |
| InChI | InChI=1S/C11H9N3OS/c15-11-7-3-1-5-12-9(7)13-10(14-11)8-4-2-6-16-8/h1-6,10H,(H,12,13)(H,14,15)/t10-/m0/s1 |
| InChIKey | IRVBNURRQMPKNJ-JTQLQIEISA-N |
| XLogP | 2.00 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-thiophen-2-yl-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-thiophen-2-yl-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one?
The IUPAC name of (2S)-2-thiophen-2-yl-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one (CID 97211396) is (2S)-2-thiophen-2-yl-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one.
What is the SMILES notation for (2S)-2-thiophen-2-yl-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one?
The canonical SMILES for (2S)-2-thiophen-2-yl-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one is O=C1N[C@@H](c2cccs2)Nc2ncccc21.
What is the InChIKey of (2S)-2-thiophen-2-yl-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one?
The InChIKey is IRVBNURRQMPKNJ-JTQLQIEISA-N. The full InChI is InChI=1S/C11H9N3OS/c15-11-7-3-1-5-12-9(7)13-10(14-11)8-4-2-6-16-8/h1-6,10H,(H,12,13)(H,14,15)/t10-/m0/s1.
What are the key properties of (2S)-2-thiophen-2-yl-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one?
(2S)-2-thiophen-2-yl-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one has a molecular weight of 231.28 g/mol, XLogP of 2.00, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-thiophen-2-yl-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 97211396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).