C20H19N5O2 — CID 97211410
N-[(1R)-1-(1H-benzimidazol-2-yl)-2-(4-hydroxyphenyl)ethyl]-2-methylpyrazole-3-carboxamide (PubChem CID 97211410) has the molecular formula C20H19N5O2 and a molecular weight of 361.41 g/mol. Its IUPAC name is N-[(1R)-1-(1H-benzimidazol-2-yl)-2-(4-hydroxyphenyl)ethyl]-2-methylpyrazole-3-carboxamide.
| Compound Name | N-[(1R)-1-(1H-benzimidazol-2-yl)-2-(4-hydroxyphenyl)ethyl]-2-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 97211410 |
| Molecular Formula | C20H19N5O2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N-[(1R)-1-(1H-benzimidazol-2-yl)-2-(4-hydroxyphenyl)ethyl]-2-methylpyrazole-3-carboxamide |
| SMILES | Cn1nccc1C(=O)N[C@H](Cc1ccc(O)cc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H19N5O2/c1-25-18(10-11-21-25)20(27)24-17(12-13-6-8-14(26)9-7-13)19-22-15-4-2-3-5-16(15)23-19/h2-11,17,26H,12H2,1H3,(H,22,23)(H,24,27)/t17-/m1/s1 |
| InChIKey | JPQVOEQSTVBJCA-QGZVFWFLSA-N |
| XLogP | 2.72 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |