C19H23N5O3 — CID 97211482
N-[(3R)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide (PubChem CID 97211482) has the molecular formula C19H23N5O3 and a molecular weight of 369.43 g/mol. Its IUPAC name is N-[(3R)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide.
| Compound Name | N-[(3R)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide |
|---|---|
| PubChem CID | 97211482 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | N-[(3R)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide |
| SMILES | CCN(C(=O)c1cc(C)nc2c1nc1n2CCCCC1)[C@@H]1CC(=O)NC1=O |
| InChI | InChI=1S/C19H23N5O3/c1-3-23(13-10-15(25)22-18(13)26)19(27)12-9-11(2)20-17-16(12)21-14-7-5-4-6-8-24(14)17/h9,13H,3-8,10H2,1-2H3,(H,22,25,26)/t13-/m1/s1 |
| InChIKey | AWQRBZIBZBNYGJ-CYBMUJFWSA-N |
| XLogP | 1.34 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|