C19H28N2OS — CID 97211675
trans-(1R,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)-N-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]cyclopropane-1-carboxamide (PubChem CID 97211675) has the molecular formula C19H28N2OS and a molecular weight of 332.51 g/mol. Its IUPAC name is trans-(1R,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)-N-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]cyclopropane-1-carboxamide.
| Compound Name | trans-(1R,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)-N-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 97211675 |
| Molecular Formula | C19H28N2OS |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | trans-(1R,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)-N-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]cyclopropane-1-carboxamide |
| SMILES | CC(C)=C[C@H]1[C@@H](C(=O)NCCc2nc3c(s2)CCCC3)C1(C)C |
| InChI | InChI=1S/C19H28N2OS/c1-12(2)11-13-17(19(13,3)4)18(22)20-10-9-16-21-14-7-5-6-8-15(14)23-16/h11,13,17H,5-10H2,1-4H3,(H,20,22)/t13-,17-/m0/s1 |
| InChIKey | STBKIVFYBMVBAT-GUYCJALGSA-N |
| XLogP | 3.92 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|