C17H24N4O — CID 97212409
1-methyl-1-[(2S)-2-methylbutyl]-3-[(2-pyrazol-1-ylphenyl)methyl]urea (PubChem CID 97212409) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is 1-methyl-1-[(2S)-2-methylbutyl]-3-[(2-pyrazol-1-ylphenyl)methyl]urea.
| Compound Name | 1-methyl-1-[(2S)-2-methylbutyl]-3-[(2-pyrazol-1-ylphenyl)methyl]urea |
|---|---|
| PubChem CID | 97212409 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 1-methyl-1-[(2S)-2-methylbutyl]-3-[(2-pyrazol-1-ylphenyl)methyl]urea |
| SMILES | CC[C@H](C)CN(C)C(=O)NCc1ccccc1-n1cccn1 |
| InChI | InChI=1S/C17H24N4O/c1-4-14(2)13-20(3)17(22)18-12-15-8-5-6-9-16(15)21-11-7-10-19-21/h5-11,14H,4,12-13H2,1-3H3,(H,18,22)/t14-/m0/s1 |
| InChIKey | USUZXCIEBBFJKL-AWEZNQCLSA-N |
| XLogP | 3.06 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |