C17H26N2O2 — CID 97213775
(2E,4E)-N-[(2S)-2-[[(2E,4E)-hexa-2,4-dienoyl]amino]-3-methylbutyl]hexa-2,4-dienamide (PubChem CID 97213775) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is (2E,4E)-N-[(2S)-2-[[(2E,4E)-hexa-2,4-dienoyl]amino]-3-methylbutyl]hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-[(2S)-2-[[(2E,4E)-hexa-2,4-dienoyl]amino]-3-methylbutyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 97213775 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | (2E,4E)-N-[(2S)-2-[[(2E,4E)-hexa-2,4-dienoyl]amino]-3-methylbutyl]hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)NC[C@@H](NC(=O)/C=C/C=C/C)C(C)C |
| InChI | InChI=1S/C17H26N2O2/c1-5-7-9-11-16(20)18-13-15(14(3)4)19-17(21)12-10-8-6-2/h5-12,14-15H,13H2,1-4H3,(H,18,20)(H,19,21)/b7-5+,8-6+,11-9+,12-10+/t15-/m1/s1 |
| InChIKey | SNAXILXDHRHUIM-WSOSKVPHSA-N |
| XLogP | 2.51 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|