C19H26N2O2 — CID 97214050
N-[4-[[(S)-[(1R,2R)-2-methylcyclopropyl]-phenylmethyl]amino]-4-oxobutyl]cyclopropanecarboxamide (PubChem CID 97214050) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is N-[4-[[(S)-[(1R,2R)-2-methylcyclopropyl]-phenylmethyl]amino]-4-oxobutyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[[(S)-[(1R,2R)-2-methylcyclopropyl]-phenylmethyl]amino]-4-oxobutyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 97214050 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | N-[4-[[(S)-[(1R,2R)-2-methylcyclopropyl]-phenylmethyl]amino]-4-oxobutyl]cyclopropanecarboxamide |
| SMILES | C[C@@H]1C[C@H]1[C@H](NC(=O)CCCNC(=O)C1CC1)c1ccccc1 |
| InChI | InChI=1S/C19H26N2O2/c1-13-12-16(13)18(14-6-3-2-4-7-14)21-17(22)8-5-11-20-19(23)15-9-10-15/h2-4,6-7,13,15-16,18H,5,8-12H2,1H3,(H,20,23)(H,21,22)/t13-,16-,18-/m1/s1 |
| InChIKey | UBIUKTAEBXAJLR-MZMPZRCHSA-N |
| XLogP | 2.81 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|