C18H22N2O3 — CID 97214314
methyl 2,3-dimethyl-5-[[(3R)-3-pyrrol-1-ylbutanoyl]amino]benzoate (PubChem CID 97214314) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is methyl 2,3-dimethyl-5-[[(3R)-3-pyrrol-1-ylbutanoyl]amino]benzoate.
| Compound Name | methyl 2,3-dimethyl-5-[[(3R)-3-pyrrol-1-ylbutanoyl]amino]benzoate |
|---|---|
| PubChem CID | 97214314 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | methyl 2,3-dimethyl-5-[[(3R)-3-pyrrol-1-ylbutanoyl]amino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)C[C@@H](C)n2cccc2)cc(C)c1C |
| InChI | InChI=1S/C18H22N2O3/c1-12-9-15(11-16(14(12)3)18(22)23-4)19-17(21)10-13(2)20-7-5-6-8-20/h5-9,11,13H,10H2,1-4H3,(H,19,21)/t13-/m1/s1 |
| InChIKey | DVNDBNPGPDVTCZ-CYBMUJFWSA-N |
| XLogP | 3.48 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |