C14H18N4S — CID 97214431
N-[(1R,3R)-3-methylsulfanylcyclohexyl]pyrido[2,3-b]pyrazin-6-amine (PubChem CID 97214431) has the molecular formula C14H18N4S and a molecular weight of 274.39 g/mol. Its IUPAC name is N-[(1R,3R)-3-methylsulfanylcyclohexyl]pyrido[2,3-b]pyrazin-6-amine.
| Compound Name | N-[(1R,3R)-3-methylsulfanylcyclohexyl]pyrido[2,3-b]pyrazin-6-amine |
|---|---|
| PubChem CID | 97214431 |
| Molecular Formula | C14H18N4S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N-[(1R,3R)-3-methylsulfanylcyclohexyl]pyrido[2,3-b]pyrazin-6-amine |
| SMILES | CS[C@@H]1CCC[C@@H](Nc2ccc3nccnc3n2)C1 |
| InChI | InChI=1S/C14H18N4S/c1-19-11-4-2-3-10(9-11)17-13-6-5-12-14(18-13)16-8-7-15-12/h5-8,10-11H,2-4,9H2,1H3,(H,16,17,18)/t10-,11-/m1/s1 |
| InChIKey | BXDLLFDTVSVYIP-GHMZBOCLSA-N |
| XLogP | 3.11 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |