C18H21N3OS — CID 97214559
2-[(2R)-2-phenylthiomorpholin-4-yl]-N-(pyridin-2-ylmethyl)acetamide (PubChem CID 97214559) has the molecular formula C18H21N3OS and a molecular weight of 327.45 g/mol. Its IUPAC name is 2-[(2R)-2-phenylthiomorpholin-4-yl]-N-(pyridin-2-ylmethyl)acetamide.
| Compound Name | 2-[(2R)-2-phenylthiomorpholin-4-yl]-N-(pyridin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 97214559 |
| Molecular Formula | C18H21N3OS |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 2-[(2R)-2-phenylthiomorpholin-4-yl]-N-(pyridin-2-ylmethyl)acetamide |
| SMILES | O=C(CN1CCS[C@H](c2ccccc2)C1)NCc1ccccn1 |
| InChI | InChI=1S/C18H21N3OS/c22-18(20-12-16-8-4-5-9-19-16)14-21-10-11-23-17(13-21)15-6-2-1-3-7-15/h1-9,17H,10-14H2,(H,20,22)/t17-/m0/s1 |
| InChIKey | AFNSVIDKXBNLBF-KRWDZBQOSA-N |
| XLogP | 2.49 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |