About 3-(4-fluorophenyl)-1-[(1S,3R)-1-oxo-3-phenyl-1,4-thiazinan-4-yl]propan-1-one
3-(4-fluorophenyl)-1-[(1S,3R)-1-oxo-3-phenyl-1,4-thiazinan-4-yl]propan-1-one (PubChem CID 97214750) has the molecular formula C19H20FNO2S
and a molecular weight of 345.44 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-[(1S,3R)-1-oxo-3-phenyl-1,4-thiazinan-4-yl]propan-1-one.
Molecular Properties
| Compound Name | 3-(4-fluorophenyl)-1-[(1S,3R)-1-oxo-3-phenyl-1,4-thiazinan-4-yl]propan-1-one |
| PubChem CID | 97214750 |
| Molecular Formula | C19H20FNO2S |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 3-(4-fluorophenyl)-1-[(1S,3R)-1-oxo-3-phenyl-1,4-thiazinan-4-yl]propan-1-one |
| SMILES | O=C(CCc1ccc(F)cc1)N1CC[S@](=O)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H20FNO2S/c20-17-9-6-15(7-10-17)8-11-19(22)21-12-13-24(23)14-18(21)16-4-2-1-3-5-16/h1-7,9-10,18H,8,11-14H2/t18-,24-/m0/s1 |
| InChIKey | KSOWOTLBASCHRI-UUOWRZLLSA-N |
| XLogP | 3.09 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-fluorophenyl)-1-[(1S,3R)-1-oxo-3-phenyl-1,4-thiazinan-4-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorophenyl)-1-[(1S,3R)-1-oxo-3-phenyl-1,4-thiazinan-4-yl]propan-1-one?
The IUPAC name of 3-(4-fluorophenyl)-1-[(1S,3R)-1-oxo-3-phenyl-1,4-thiazinan-4-yl]propan-1-one (CID 97214750) is 3-(4-fluorophenyl)-1-[(1S,3R)-1-oxo-3-phenyl-1,4-thiazinan-4-yl]propan-1-one.
What is the SMILES notation for 3-(4-fluorophenyl)-1-[(1S,3R)-1-oxo-3-phenyl-1,4-thiazinan-4-yl]propan-1-one?
The canonical SMILES for 3-(4-fluorophenyl)-1-[(1S,3R)-1-oxo-3-phenyl-1,4-thiazinan-4-yl]propan-1-one is O=C(CCc1ccc(F)cc1)N1CC[S@](=O)C[C@H]1c1ccccc1.
What is the InChIKey of 3-(4-fluorophenyl)-1-[(1S,3R)-1-oxo-3-phenyl-1,4-thiazinan-4-yl]propan-1-one?
The InChIKey is KSOWOTLBASCHRI-UUOWRZLLSA-N. The full InChI is InChI=1S/C19H20FNO2S/c20-17-9-6-15(7-10-17)8-11-19(22)21-12-13-24(23)14-18(21)16-4-2-1-3-5-16/h1-7,9-10,18H,8,11-14H2/t18-,24-/m0/s1.
What are the key properties of 3-(4-fluorophenyl)-1-[(1S,3R)-1-oxo-3-phenyl-1,4-thiazinan-4-yl]propan-1-one?
3-(4-fluorophenyl)-1-[(1S,3R)-1-oxo-3-phenyl-1,4-thiazinan-4-yl]propan-1-one has a molecular weight of 345.44 g/mol, XLogP of 3.09, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)-1-[(1S,3R)-1-oxo-3-phenyl-1,4-thiazinan-4-yl]propan-1-one is sourced from PubChem (CID 97214750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).