C17H26N4O — CID 97214771
(2R)-N-[2-(cyclohexen-1-yl)ethyl]-2-(1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-5-yl)propanamide (PubChem CID 97214771) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is (2R)-N-[2-(cyclohexen-1-yl)ethyl]-2-(1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-5-yl)propanamide.
| Compound Name | (2R)-N-[2-(cyclohexen-1-yl)ethyl]-2-(1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-5-yl)propanamide |
|---|---|
| PubChem CID | 97214771 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | (2R)-N-[2-(cyclohexen-1-yl)ethyl]-2-(1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-5-yl)propanamide |
| SMILES | C[C@H](C(=O)NCCC1=CCCCC1)N1CCc2[nH]ncc2C1 |
| InChI | InChI=1S/C17H26N4O/c1-13(21-10-8-16-15(12-21)11-19-20-16)17(22)18-9-7-14-5-3-2-4-6-14/h5,11,13H,2-4,6-10,12H2,1H3,(H,18,22)(H,19,20)/t13-/m1/s1 |
| InChIKey | TVDOZJOOWSSFEB-CYBMUJFWSA-N |
| XLogP | 2.16 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|