C9H22N2O2S — CID 97215224
(3S)-2,2,5-trimethyl-3-(sulfamoylamino)hexane (PubChem CID 97215224) has the molecular formula C9H22N2O2S and a molecular weight of 222.35 g/mol. Its IUPAC name is (3S)-2,2,5-trimethyl-3-(sulfamoylamino)hexane.
| Compound Name | (3S)-2,2,5-trimethyl-3-(sulfamoylamino)hexane |
|---|---|
| PubChem CID | 97215224 |
| Molecular Formula | C9H22N2O2S |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | (3S)-2,2,5-trimethyl-3-(sulfamoylamino)hexane |
| SMILES | CC(C)C[C@H](NS(N)(=O)=O)C(C)(C)C |
| InChI | InChI=1S/C9H22N2O2S/c1-7(2)6-8(9(3,4)5)11-14(10,12)13/h7-8,11H,6H2,1-5H3,(H2,10,12,13)/t8-/m0/s1 |
| InChIKey | FKEIPYPWNAESCH-QMMMGPOBSA-N |
| XLogP | 1.24 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |