C23H26N2O2 — CID 97215439
[(6R)-2-azaspiro[5.5]undec-9-en-2-yl]-[2-(pyridin-3-ylmethoxy)phenyl]methanone (PubChem CID 97215439) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is [(6R)-2-azaspiro[5.5]undec-9-en-2-yl]-[2-(pyridin-3-ylmethoxy)phenyl]methanone.
| Compound Name | [(6R)-2-azaspiro[5.5]undec-9-en-2-yl]-[2-(pyridin-3-ylmethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 97215439 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | [(6R)-2-azaspiro[5.5]undec-9-en-2-yl]-[2-(pyridin-3-ylmethoxy)phenyl]methanone |
| SMILES | O=C(c1ccccc1OCc1cccnc1)N1CCC[C@]2(CC=CCC2)C1 |
| InChI | InChI=1S/C23H26N2O2/c26-22(25-15-7-13-23(18-25)11-4-1-5-12-23)20-9-2-3-10-21(20)27-17-19-8-6-14-24-16-19/h1-4,6,8-10,14,16H,5,7,11-13,15,17-18H2/t23-/m1/s1 |
| InChIKey | CVYKXQICBVCRDO-HSZRJFAPSA-N |
| XLogP | 4.62 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|