About 1-pentyl-3-[(2S)-2-(1,3-thiazol-2-yl)butan-2-yl]urea
1-pentyl-3-[(2S)-2-(1,3-thiazol-2-yl)butan-2-yl]urea (PubChem CID 97215596) has the molecular formula C13H23N3OS
and a molecular weight of 269.41 g/mol. Its IUPAC name is 1-pentyl-3-[(2S)-2-(1,3-thiazol-2-yl)butan-2-yl]urea.
Molecular Properties
| Compound Name | 1-pentyl-3-[(2S)-2-(1,3-thiazol-2-yl)butan-2-yl]urea |
| PubChem CID | 97215596 |
| Molecular Formula | C13H23N3OS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 1-pentyl-3-[(2S)-2-(1,3-thiazol-2-yl)butan-2-yl]urea |
| SMILES | CCCCCNC(=O)N[C@@](C)(CC)c1nccs1 |
| InChI | InChI=1S/C13H23N3OS/c1-4-6-7-8-15-12(17)16-13(3,5-2)11-14-9-10-18-11/h9-10H,4-8H2,1-3H3,(H2,15,16,17)/t13-/m0/s1 |
| InChIKey | JDGHGVFALPXEGO-ZDUSSCGKSA-N |
| XLogP | 3.26 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-pentyl-3-[(2S)-2-(1,3-thiazol-2-yl)butan-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pentyl-3-[(2S)-2-(1,3-thiazol-2-yl)butan-2-yl]urea?
The IUPAC name of 1-pentyl-3-[(2S)-2-(1,3-thiazol-2-yl)butan-2-yl]urea (CID 97215596) is 1-pentyl-3-[(2S)-2-(1,3-thiazol-2-yl)butan-2-yl]urea.
What is the SMILES notation for 1-pentyl-3-[(2S)-2-(1,3-thiazol-2-yl)butan-2-yl]urea?
The canonical SMILES for 1-pentyl-3-[(2S)-2-(1,3-thiazol-2-yl)butan-2-yl]urea is CCCCCNC(=O)N[C@@](C)(CC)c1nccs1.
What is the InChIKey of 1-pentyl-3-[(2S)-2-(1,3-thiazol-2-yl)butan-2-yl]urea?
The InChIKey is JDGHGVFALPXEGO-ZDUSSCGKSA-N. The full InChI is InChI=1S/C13H23N3OS/c1-4-6-7-8-15-12(17)16-13(3,5-2)11-14-9-10-18-11/h9-10H,4-8H2,1-3H3,(H2,15,16,17)/t13-/m0/s1.
What are the key properties of 1-pentyl-3-[(2S)-2-(1,3-thiazol-2-yl)butan-2-yl]urea?
1-pentyl-3-[(2S)-2-(1,3-thiazol-2-yl)butan-2-yl]urea has a molecular weight of 269.41 g/mol, XLogP of 3.26, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pentyl-3-[(2S)-2-(1,3-thiazol-2-yl)butan-2-yl]urea is sourced from PubChem (CID 97215596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).