About 1-[[(3R)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]methyl]-4-methylcyclohexan-1-ol
1-[[(3R)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]methyl]-4-methylcyclohexan-1-ol (PubChem CID 97216802) has the molecular formula C16H29NO3
and a molecular weight of 283.41 g/mol. Its IUPAC name is 1-[[(3R)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]methyl]-4-methylcyclohexan-1-ol.
Molecular Properties
| Compound Name | 1-[[(3R)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]methyl]-4-methylcyclohexan-1-ol |
| PubChem CID | 97216802 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 1-[[(3R)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]methyl]-4-methylcyclohexan-1-ol |
| SMILES | CC1CCC(O)(CN2CCC[C@@H](C3OCCO3)C2)CC1 |
| InChI | InChI=1S/C16H29NO3/c1-13-4-6-16(18,7-5-13)12-17-8-2-3-14(11-17)15-19-9-10-20-15/h13-15,18H,2-12H2,1H3/t13?,14-,16?/m1/s1 |
| InChIKey | SZLMGEMCCNVFAH-NPCAHTBFSA-N |
| XLogP | 2.01 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[(3R)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]methyl]-4-methylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(3R)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]methyl]-4-methylcyclohexan-1-ol?
The IUPAC name of 1-[[(3R)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]methyl]-4-methylcyclohexan-1-ol (CID 97216802) is 1-[[(3R)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]methyl]-4-methylcyclohexan-1-ol.
What is the SMILES notation for 1-[[(3R)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]methyl]-4-methylcyclohexan-1-ol?
The canonical SMILES for 1-[[(3R)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]methyl]-4-methylcyclohexan-1-ol is CC1CCC(O)(CN2CCC[C@@H](C3OCCO3)C2)CC1.
What is the InChIKey of 1-[[(3R)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]methyl]-4-methylcyclohexan-1-ol?
The InChIKey is SZLMGEMCCNVFAH-NPCAHTBFSA-N. The full InChI is InChI=1S/C16H29NO3/c1-13-4-6-16(18,7-5-13)12-17-8-2-3-14(11-17)15-19-9-10-20-15/h13-15,18H,2-12H2,1H3/t13?,14-,16?/m1/s1.
What are the key properties of 1-[[(3R)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]methyl]-4-methylcyclohexan-1-ol?
1-[[(3R)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]methyl]-4-methylcyclohexan-1-ol has a molecular weight of 283.41 g/mol, XLogP of 2.01, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(3R)-3-(1,3-dioxolan-2-yl)piperidin-1-yl]methyl]-4-methylcyclohexan-1-ol is sourced from PubChem (CID 97216802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).