C14H23N3O3S — CID 97217221
3-ethoxy-N-[[(2R)-4-methylmorpholin-2-yl]methyl]-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 97217221) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is 3-ethoxy-N-[[(2R)-4-methylmorpholin-2-yl]methyl]-N-(1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-ethoxy-N-[[(2R)-4-methylmorpholin-2-yl]methyl]-N-(1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 97217221 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 3-ethoxy-N-[[(2R)-4-methylmorpholin-2-yl]methyl]-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | CCOCCC(=O)N(C[C@H]1CN(C)CCO1)c1nccs1 |
| InChI | InChI=1S/C14H23N3O3S/c1-3-19-7-4-13(18)17(14-15-5-9-21-14)11-12-10-16(2)6-8-20-12/h5,9,12H,3-4,6-8,10-11H2,1-2H3/t12-/m1/s1 |
| InChIKey | UDWNVQWGSCJDMS-GFCCVEGCSA-N |
| XLogP | 1.23 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|