C16H22N4O2 — CID 97217835
4-[(2R,3aR,7aS)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile (PubChem CID 97217835) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 4-[(2R,3aR,7aS)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile.
| Compound Name | 4-[(2R,3aR,7aS)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 97217835 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 4-[(2R,3aR,7aS)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile |
| SMILES | C[C@@H]1C[C@H]2CCCC[C@@H]2N1c1c(C#N)c(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C16H22N4O2/c1-10-8-11-6-4-5-7-13(11)20(10)14-12(9-17)15(21)19(3)16(22)18(14)2/h10-11,13H,4-8H2,1-3H3/t10-,11-,13+/m1/s1 |
| InChIKey | VIUAEFTXDLTWPU-WZRBSPASSA-N |
| XLogP | 1.11 |
| TPSA | 71.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |