About N-methyl-3-[(2S,5R)-5-methyloxolan-2-yl]-N-[(4-nitrophenyl)methyl]propanamide
N-methyl-3-[(2S,5R)-5-methyloxolan-2-yl]-N-[(4-nitrophenyl)methyl]propanamide (PubChem CID 97218664) has the molecular formula C16H22N2O4
and a molecular weight of 306.36 g/mol. Its IUPAC name is N-methyl-3-[(2S,5R)-5-methyloxolan-2-yl]-N-[(4-nitrophenyl)methyl]propanamide.
Molecular Properties
| Compound Name | N-methyl-3-[(2S,5R)-5-methyloxolan-2-yl]-N-[(4-nitrophenyl)methyl]propanamide |
| PubChem CID | 97218664 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | N-methyl-3-[(2S,5R)-5-methyloxolan-2-yl]-N-[(4-nitrophenyl)methyl]propanamide |
| SMILES | C[C@@H]1CC[C@@H](CCC(=O)N(C)Cc2ccc([N+](=O)[O-])cc2)O1 |
| InChI | InChI=1S/C16H22N2O4/c1-12-3-8-15(22-12)9-10-16(19)17(2)11-13-4-6-14(7-5-13)18(20)21/h4-7,12,15H,3,8-11H2,1-2H3/t12-,15+/m1/s1 |
| InChIKey | MXKLNUBQQPESSA-DOMZBBRYSA-N |
| XLogP | 2.90 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-3-[(2S,5R)-5-methyloxolan-2-yl]-N-[(4-nitrophenyl)methyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3-[(2S,5R)-5-methyloxolan-2-yl]-N-[(4-nitrophenyl)methyl]propanamide?
The IUPAC name of N-methyl-3-[(2S,5R)-5-methyloxolan-2-yl]-N-[(4-nitrophenyl)methyl]propanamide (CID 97218664) is N-methyl-3-[(2S,5R)-5-methyloxolan-2-yl]-N-[(4-nitrophenyl)methyl]propanamide.
What is the SMILES notation for N-methyl-3-[(2S,5R)-5-methyloxolan-2-yl]-N-[(4-nitrophenyl)methyl]propanamide?
The canonical SMILES for N-methyl-3-[(2S,5R)-5-methyloxolan-2-yl]-N-[(4-nitrophenyl)methyl]propanamide is C[C@@H]1CC[C@@H](CCC(=O)N(C)Cc2ccc([N+](=O)[O-])cc2)O1.
What is the InChIKey of N-methyl-3-[(2S,5R)-5-methyloxolan-2-yl]-N-[(4-nitrophenyl)methyl]propanamide?
The InChIKey is MXKLNUBQQPESSA-DOMZBBRYSA-N. The full InChI is InChI=1S/C16H22N2O4/c1-12-3-8-15(22-12)9-10-16(19)17(2)11-13-4-6-14(7-5-13)18(20)21/h4-7,12,15H,3,8-11H2,1-2H3/t12-,15+/m1/s1.
What are the key properties of N-methyl-3-[(2S,5R)-5-methyloxolan-2-yl]-N-[(4-nitrophenyl)methyl]propanamide?
N-methyl-3-[(2S,5R)-5-methyloxolan-2-yl]-N-[(4-nitrophenyl)methyl]propanamide has a molecular weight of 306.36 g/mol, XLogP of 2.90, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3-[(2S,5R)-5-methyloxolan-2-yl]-N-[(4-nitrophenyl)methyl]propanamide is sourced from PubChem (CID 97218664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).