C18H20N2O2S — CID 97218743
(2R)-N-[(R)-(3-methoxyphenyl)-pyridin-3-ylmethyl]thiolane-2-carboxamide (PubChem CID 97218743) has the molecular formula C18H20N2O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is (2R)-N-[(R)-(3-methoxyphenyl)-pyridin-3-ylmethyl]thiolane-2-carboxamide.
| Compound Name | (2R)-N-[(R)-(3-methoxyphenyl)-pyridin-3-ylmethyl]thiolane-2-carboxamide |
|---|---|
| PubChem CID | 97218743 |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | (2R)-N-[(R)-(3-methoxyphenyl)-pyridin-3-ylmethyl]thiolane-2-carboxamide |
| SMILES | COc1cccc([C@@H](NC(=O)[C@H]2CCCS2)c2cccnc2)c1 |
| InChI | InChI=1S/C18H20N2O2S/c1-22-15-7-2-5-13(11-15)17(14-6-3-9-19-12-14)20-18(21)16-8-4-10-23-16/h2-3,5-7,9,11-12,16-17H,4,8,10H2,1H3,(H,20,21)/t16-,17-/m1/s1 |
| InChIKey | BCORIMLLJOWYHS-IAGOWNOFSA-N |
| XLogP | 3.19 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |