C13H15N5 — CID 97218844
8-[(3aR,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 97218844) has the molecular formula C13H15N5 and a molecular weight of 241.30 g/mol. Its IUPAC name is 8-[(3aR,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 8-[(3aR,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 97218844 |
| Molecular Formula | C13H15N5 |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 8-[(3aR,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | C1=CC[C@H]2CN(c3nccn4cnnc34)C[C@@H]2C1 |
| InChI | InChI=1S/C13H15N5/c1-2-4-11-8-18(7-10(11)3-1)12-13-16-15-9-17(13)6-5-14-12/h1-2,5-6,9-11H,3-4,7-8H2/t10-,11-/m0/s1 |
| InChIKey | URLBVWGUXDYZEN-QWRGUYRKSA-N |
| XLogP | 1.53 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|