C16H17F3O4 — CID 97219313
2-(2,2,2-trifluoroethoxy)ethyl (1'S,4R)-spiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carboxylate (PubChem CID 97219313) has the molecular formula C16H17F3O4 and a molecular weight of 330.30 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethoxy)ethyl (1'S,4R)-spiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carboxylate.
| Compound Name | 2-(2,2,2-trifluoroethoxy)ethyl (1'S,4R)-spiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carboxylate |
|---|---|
| PubChem CID | 97219313 |
| Molecular Formula | C16H17F3O4 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 2-(2,2,2-trifluoroethoxy)ethyl (1'S,4R)-spiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carboxylate |
| SMILES | O=C(OCCOCC(F)(F)F)[C@H]1C[C@@]12CCOc1ccccc12 |
| InChI | InChI=1S/C16H17F3O4/c17-16(18,19)10-21-7-8-23-14(20)12-9-15(12)5-6-22-13-4-2-1-3-11(13)15/h1-4,12H,5-10H2/t12-,15-/m1/s1 |
| InChIKey | ZSFUTKYKZJCJRY-IUODEOHRSA-N |
| XLogP | 2.85 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|