About [(3R)-1-ethyl-5-oxopyrrolidin-3-yl]methyl 3-methylimidazo[1,5-a]pyridine-1-carboxylate
[(3R)-1-ethyl-5-oxopyrrolidin-3-yl]methyl 3-methylimidazo[1,5-a]pyridine-1-carboxylate (PubChem CID 97219335) has the molecular formula C16H19N3O3
and a molecular weight of 301.35 g/mol. Its IUPAC name is [(3R)-1-ethyl-5-oxopyrrolidin-3-yl]methyl 3-methylimidazo[1,5-a]pyridine-1-carboxylate.
Molecular Properties
| Compound Name | [(3R)-1-ethyl-5-oxopyrrolidin-3-yl]methyl 3-methylimidazo[1,5-a]pyridine-1-carboxylate |
| PubChem CID | 97219335 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | [(3R)-1-ethyl-5-oxopyrrolidin-3-yl]methyl 3-methylimidazo[1,5-a]pyridine-1-carboxylate |
| SMILES | CCN1C[C@H](COC(=O)c2nc(C)n3ccccc23)CC1=O |
| InChI | InChI=1S/C16H19N3O3/c1-3-18-9-12(8-14(18)20)10-22-16(21)15-13-6-4-5-7-19(13)11(2)17-15/h4-7,12H,3,8-10H2,1-2H3/t12-/m1/s1 |
| InChIKey | HGXISUWJEQHXPZ-GFCCVEGCSA-N |
| XLogP | 1.67 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(3R)-1-ethyl-5-oxopyrrolidin-3-yl]methyl 3-methylimidazo[1,5-a]pyridine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-1-ethyl-5-oxopyrrolidin-3-yl]methyl 3-methylimidazo[1,5-a]pyridine-1-carboxylate?
The IUPAC name of [(3R)-1-ethyl-5-oxopyrrolidin-3-yl]methyl 3-methylimidazo[1,5-a]pyridine-1-carboxylate (CID 97219335) is [(3R)-1-ethyl-5-oxopyrrolidin-3-yl]methyl 3-methylimidazo[1,5-a]pyridine-1-carboxylate.
What is the SMILES notation for [(3R)-1-ethyl-5-oxopyrrolidin-3-yl]methyl 3-methylimidazo[1,5-a]pyridine-1-carboxylate?
The canonical SMILES for [(3R)-1-ethyl-5-oxopyrrolidin-3-yl]methyl 3-methylimidazo[1,5-a]pyridine-1-carboxylate is CCN1C[C@H](COC(=O)c2nc(C)n3ccccc23)CC1=O.
What is the InChIKey of [(3R)-1-ethyl-5-oxopyrrolidin-3-yl]methyl 3-methylimidazo[1,5-a]pyridine-1-carboxylate?
The InChIKey is HGXISUWJEQHXPZ-GFCCVEGCSA-N. The full InChI is InChI=1S/C16H19N3O3/c1-3-18-9-12(8-14(18)20)10-22-16(21)15-13-6-4-5-7-19(13)11(2)17-15/h4-7,12H,3,8-10H2,1-2H3/t12-/m1/s1.
What are the key properties of [(3R)-1-ethyl-5-oxopyrrolidin-3-yl]methyl 3-methylimidazo[1,5-a]pyridine-1-carboxylate?
[(3R)-1-ethyl-5-oxopyrrolidin-3-yl]methyl 3-methylimidazo[1,5-a]pyridine-1-carboxylate has a molecular weight of 301.35 g/mol, XLogP of 1.67, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-1-ethyl-5-oxopyrrolidin-3-yl]methyl 3-methylimidazo[1,5-a]pyridine-1-carboxylate is sourced from PubChem (CID 97219335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).