C14H25N3O2 — CID 97219837
1,3-dicyclopropyl-2-[2-[[(2S)-oxolan-2-yl]methoxy]ethyl]guanidine (PubChem CID 97219837) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is 1,3-dicyclopropyl-2-[2-[[(2S)-oxolan-2-yl]methoxy]ethyl]guanidine.
| Compound Name | 1,3-dicyclopropyl-2-[2-[[(2S)-oxolan-2-yl]methoxy]ethyl]guanidine |
|---|---|
| PubChem CID | 97219837 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | 1,3-dicyclopropyl-2-[2-[[(2S)-oxolan-2-yl]methoxy]ethyl]guanidine |
| SMILES | C1CO[C@H](COCCN=C(NC2CC2)NC2CC2)C1 |
| InChI | InChI=1S/C14H25N3O2/c1-2-13(19-8-1)10-18-9-7-15-14(16-11-3-4-11)17-12-5-6-12/h11-13H,1-10H2,(H2,15,16,17)/t13-/m0/s1 |
| InChIKey | QYEAHZXBUUFBJV-ZDUSSCGKSA-N |
| XLogP | 1.04 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|