C15H24N2O3S — CID 97219859
1-[(2R)-2-(1-methylpyrrol-2-yl)piperidin-1-yl]-4-methylsulfonylbutan-1-one (PubChem CID 97219859) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is 1-[(2R)-2-(1-methylpyrrol-2-yl)piperidin-1-yl]-4-methylsulfonylbutan-1-one.
| Compound Name | 1-[(2R)-2-(1-methylpyrrol-2-yl)piperidin-1-yl]-4-methylsulfonylbutan-1-one |
|---|---|
| PubChem CID | 97219859 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 1-[(2R)-2-(1-methylpyrrol-2-yl)piperidin-1-yl]-4-methylsulfonylbutan-1-one |
| SMILES | Cn1cccc1[C@H]1CCCCN1C(=O)CCCS(C)(=O)=O |
| InChI | InChI=1S/C15H24N2O3S/c1-16-10-5-8-13(16)14-7-3-4-11-17(14)15(18)9-6-12-21(2,19)20/h5,8,10,14H,3-4,6-7,9,11-12H2,1-2H3/t14-/m1/s1 |
| InChIKey | ZBDOFTHZXBZJDE-CQSZACIVSA-N |
| XLogP | 1.90 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |