C16H21N5O4 — CID 97220311
(5R,9S)-9-[[[4-(methylamino)-3-nitrophenyl]methylamino]methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 97220311) has the molecular formula C16H21N5O4 and a molecular weight of 347.38 g/mol. Its IUPAC name is (5R,9S)-9-[[[4-(methylamino)-3-nitrophenyl]methylamino]methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | (5R,9S)-9-[[[4-(methylamino)-3-nitrophenyl]methylamino]methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 97220311 |
| Molecular Formula | C16H21N5O4 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | (5R,9S)-9-[[[4-(methylamino)-3-nitrophenyl]methylamino]methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | CNc1ccc(CNC[C@@H]2CCC[C@@]23NC(=O)NC3=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H21N5O4/c1-17-12-5-4-10(7-13(12)21(24)25)8-18-9-11-3-2-6-16(11)14(22)19-15(23)20-16/h4-5,7,11,17-18H,2-3,6,8-9H2,1H3,(H2,19,20,22,23)/t11-,16+/m0/s1 |
| InChIKey | WYHJKIMBDUJETE-MEDUHNTESA-N |
| XLogP | 1.10 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|