C20H21N3O2 — CID 97221268
N-[(2S)-1-hydroxypropan-2-yl]-4-(quinolin-8-ylmethylamino)benzamide (PubChem CID 97221268) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is N-[(2S)-1-hydroxypropan-2-yl]-4-(quinolin-8-ylmethylamino)benzamide.
| Compound Name | N-[(2S)-1-hydroxypropan-2-yl]-4-(quinolin-8-ylmethylamino)benzamide |
|---|---|
| PubChem CID | 97221268 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | N-[(2S)-1-hydroxypropan-2-yl]-4-(quinolin-8-ylmethylamino)benzamide |
| SMILES | C[C@@H](CO)NC(=O)c1ccc(NCc2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C20H21N3O2/c1-14(13-24)23-20(25)16-7-9-18(10-8-16)22-12-17-5-2-4-15-6-3-11-21-19(15)17/h2-11,14,22,24H,12-13H2,1H3,(H,23,25)/t14-/m0/s1 |
| InChIKey | UBCXPXDKSGAVAM-AWEZNQCLSA-N |
| XLogP | 2.96 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |