C16H16N4O3 — CID 97221820
6-[[(1R)-1-(7-methoxy-1-benzofuran-2-yl)ethyl]amino]pyrazine-2-carboxamide (PubChem CID 97221820) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is 6-[[(1R)-1-(7-methoxy-1-benzofuran-2-yl)ethyl]amino]pyrazine-2-carboxamide.
| Compound Name | 6-[[(1R)-1-(7-methoxy-1-benzofuran-2-yl)ethyl]amino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 97221820 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 6-[[(1R)-1-(7-methoxy-1-benzofuran-2-yl)ethyl]amino]pyrazine-2-carboxamide |
| SMILES | COc1cccc2cc([C@@H](C)Nc3cncc(C(N)=O)n3)oc12 |
| InChI | InChI=1S/C16H16N4O3/c1-9(19-14-8-18-7-11(20-14)16(17)21)13-6-10-4-3-5-12(22-2)15(10)23-13/h3-9H,1-2H3,(H2,17,21)(H,19,20)/t9-/m1/s1 |
| InChIKey | IEHXZVZLNLFQKF-SECBINFHSA-N |
| XLogP | 2.50 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |