C19H21ClFN3O — CID 97222318
N-(5-amino-2-fluorophenyl)-3-[[(S)-(4-chlorophenyl)-cyclopropylmethyl]amino]propanamide (PubChem CID 97222318) has the molecular formula C19H21ClFN3O and a molecular weight of 361.85 g/mol. Its IUPAC name is N-(5-amino-2-fluorophenyl)-3-[[(S)-(4-chlorophenyl)-cyclopropylmethyl]amino]propanamide.
| Compound Name | N-(5-amino-2-fluorophenyl)-3-[[(S)-(4-chlorophenyl)-cyclopropylmethyl]amino]propanamide |
|---|---|
| PubChem CID | 97222318 |
| Molecular Formula | C19H21ClFN3O |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | N-(5-amino-2-fluorophenyl)-3-[[(S)-(4-chlorophenyl)-cyclopropylmethyl]amino]propanamide |
| SMILES | Nc1ccc(F)c(NC(=O)CCN[C@H](c2ccc(Cl)cc2)C2CC2)c1 |
| InChI | InChI=1S/C19H21ClFN3O/c20-14-5-3-13(4-6-14)19(12-1-2-12)23-10-9-18(25)24-17-11-15(22)7-8-16(17)21/h3-8,11-12,19,23H,1-2,9-10,22H2,(H,24,25)/t19-/m0/s1 |
| InChIKey | PYANRDIOODUMIH-IBGZPJMESA-N |
| XLogP | 4.13 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|