About [(2S,3R)-1-methyl-5-oxo-2-thiophen-2-ylpyrrolidin-3-yl]methyl 4-cyano-1-methylpyrrole-2-carboxylate
[(2S,3R)-1-methyl-5-oxo-2-thiophen-2-ylpyrrolidin-3-yl]methyl 4-cyano-1-methylpyrrole-2-carboxylate (PubChem CID 97222380) has the molecular formula C17H17N3O3S
and a molecular weight of 343.41 g/mol. Its IUPAC name is [(2S,3R)-1-methyl-5-oxo-2-thiophen-2-ylpyrrolidin-3-yl]methyl 4-cyano-1-methylpyrrole-2-carboxylate.
Molecular Properties
| Compound Name | [(2S,3R)-1-methyl-5-oxo-2-thiophen-2-ylpyrrolidin-3-yl]methyl 4-cyano-1-methylpyrrole-2-carboxylate |
| PubChem CID | 97222380 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | [(2S,3R)-1-methyl-5-oxo-2-thiophen-2-ylpyrrolidin-3-yl]methyl 4-cyano-1-methylpyrrole-2-carboxylate |
| SMILES | CN1C(=O)C[C@@H](COC(=O)c2cc(C#N)cn2C)[C@H]1c1cccs1 |
| InChI | InChI=1S/C17H17N3O3S/c1-19-9-11(8-18)6-13(19)17(22)23-10-12-7-15(21)20(2)16(12)14-4-3-5-24-14/h3-6,9,12,16H,7,10H2,1-2H3/t12-,16-/m0/s1 |
| InChIKey | SRCSFBXBTDSQRU-LRDDRELGSA-N |
| XLogP | 2.33 |
| TPSA | 75.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(2S,3R)-1-methyl-5-oxo-2-thiophen-2-ylpyrrolidin-3-yl]methyl 4-cyano-1-methylpyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3R)-1-methyl-5-oxo-2-thiophen-2-ylpyrrolidin-3-yl]methyl 4-cyano-1-methylpyrrole-2-carboxylate?
The IUPAC name of [(2S,3R)-1-methyl-5-oxo-2-thiophen-2-ylpyrrolidin-3-yl]methyl 4-cyano-1-methylpyrrole-2-carboxylate (CID 97222380) is [(2S,3R)-1-methyl-5-oxo-2-thiophen-2-ylpyrrolidin-3-yl]methyl 4-cyano-1-methylpyrrole-2-carboxylate.
What is the SMILES notation for [(2S,3R)-1-methyl-5-oxo-2-thiophen-2-ylpyrrolidin-3-yl]methyl 4-cyano-1-methylpyrrole-2-carboxylate?
The canonical SMILES for [(2S,3R)-1-methyl-5-oxo-2-thiophen-2-ylpyrrolidin-3-yl]methyl 4-cyano-1-methylpyrrole-2-carboxylate is CN1C(=O)C[C@@H](COC(=O)c2cc(C#N)cn2C)[C@H]1c1cccs1.
What is the InChIKey of [(2S,3R)-1-methyl-5-oxo-2-thiophen-2-ylpyrrolidin-3-yl]methyl 4-cyano-1-methylpyrrole-2-carboxylate?
The InChIKey is SRCSFBXBTDSQRU-LRDDRELGSA-N. The full InChI is InChI=1S/C17H17N3O3S/c1-19-9-11(8-18)6-13(19)17(22)23-10-12-7-15(21)20(2)16(12)14-4-3-5-24-14/h3-6,9,12,16H,7,10H2,1-2H3/t12-,16-/m0/s1.
What are the key properties of [(2S,3R)-1-methyl-5-oxo-2-thiophen-2-ylpyrrolidin-3-yl]methyl 4-cyano-1-methylpyrrole-2-carboxylate?
[(2S,3R)-1-methyl-5-oxo-2-thiophen-2-ylpyrrolidin-3-yl]methyl 4-cyano-1-methylpyrrole-2-carboxylate has a molecular weight of 343.41 g/mol, XLogP of 2.33, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3R)-1-methyl-5-oxo-2-thiophen-2-ylpyrrolidin-3-yl]methyl 4-cyano-1-methylpyrrole-2-carboxylate is sourced from PubChem (CID 97222380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).