C15H26N4O2 — CID 97222464
1-[(3R)-1-(2-methoxyethyl)piperidin-3-yl]-3-(2-pyrrol-1-ylethyl)urea (PubChem CID 97222464) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 1-[(3R)-1-(2-methoxyethyl)piperidin-3-yl]-3-(2-pyrrol-1-ylethyl)urea.
| Compound Name | 1-[(3R)-1-(2-methoxyethyl)piperidin-3-yl]-3-(2-pyrrol-1-ylethyl)urea |
|---|---|
| PubChem CID | 97222464 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 1-[(3R)-1-(2-methoxyethyl)piperidin-3-yl]-3-(2-pyrrol-1-ylethyl)urea |
| SMILES | COCCN1CCC[C@@H](NC(=O)NCCn2cccc2)C1 |
| InChI | InChI=1S/C15H26N4O2/c1-21-12-11-19-9-4-5-14(13-19)17-15(20)16-6-10-18-7-2-3-8-18/h2-3,7-8,14H,4-6,9-13H2,1H3,(H2,16,17,20)/t14-/m1/s1 |
| InChIKey | YSZRZFRQMCAHPS-CQSZACIVSA-N |
| XLogP | 0.90 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |