C19H25N5O — CID 97222883
1-[[(1'S,3S)-spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yl]methyl]-3-[(2R)-4-(1,2,4-triazol-1-yl)butan-2-yl]urea (PubChem CID 97222883) has the molecular formula C19H25N5O and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-[[(1'S,3S)-spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yl]methyl]-3-[(2R)-4-(1,2,4-triazol-1-yl)butan-2-yl]urea.
| Compound Name | 1-[[(1'S,3S)-spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yl]methyl]-3-[(2R)-4-(1,2,4-triazol-1-yl)butan-2-yl]urea |
|---|---|
| PubChem CID | 97222883 |
| Molecular Formula | C19H25N5O |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | 1-[[(1'S,3S)-spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yl]methyl]-3-[(2R)-4-(1,2,4-triazol-1-yl)butan-2-yl]urea |
| SMILES | C[C@H](CCn1cncn1)NC(=O)NC[C@H]1C[C@@]12CCc1ccccc12 |
| InChI | InChI=1S/C19H25N5O/c1-14(7-9-24-13-20-12-22-24)23-18(25)21-11-16-10-19(16)8-6-15-4-2-3-5-17(15)19/h2-5,12-14,16H,6-11H2,1H3,(H2,21,23,25)/t14-,16-,19+/m1/s1 |
| InChIKey | UFEGZVCLXATGKU-OGWOLHLISA-N |
| XLogP | 2.26 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |