C15H20N4O — CID 97223312
[(1R,2S)-2-(pyrido[2,3-b]pyrazin-6-ylamino)cycloheptyl]methanol (PubChem CID 97223312) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is [(1R,2S)-2-(pyrido[2,3-b]pyrazin-6-ylamino)cycloheptyl]methanol.
| Compound Name | [(1R,2S)-2-(pyrido[2,3-b]pyrazin-6-ylamino)cycloheptyl]methanol |
|---|---|
| PubChem CID | 97223312 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | [(1R,2S)-2-(pyrido[2,3-b]pyrazin-6-ylamino)cycloheptyl]methanol |
| SMILES | OC[C@@H]1CCCCC[C@@H]1Nc1ccc2nccnc2n1 |
| InChI | InChI=1S/C15H20N4O/c20-10-11-4-2-1-3-5-12(11)18-14-7-6-13-15(19-14)17-9-8-16-13/h6-9,11-12,20H,1-5,10H2,(H,17,18,19)/t11-,12-/m0/s1 |
| InChIKey | CTVCHAPCJDOOBI-RYUDHWBXSA-N |
| XLogP | 2.38 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |