C16H19N5O — CID 97223856
1-[(1S)-cyclohex-2-en-1-yl]-3-[(1-phenyltriazol-4-yl)methyl]urea (PubChem CID 97223856) has the molecular formula C16H19N5O and a molecular weight of 297.36 g/mol. Its IUPAC name is 1-[(1S)-cyclohex-2-en-1-yl]-3-[(1-phenyltriazol-4-yl)methyl]urea.
| Compound Name | 1-[(1S)-cyclohex-2-en-1-yl]-3-[(1-phenyltriazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 97223856 |
| Molecular Formula | C16H19N5O |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 1-[(1S)-cyclohex-2-en-1-yl]-3-[(1-phenyltriazol-4-yl)methyl]urea |
| SMILES | O=C(NCc1cn(-c2ccccc2)nn1)N[C@@H]1C=CCCC1 |
| InChI | InChI=1S/C16H19N5O/c22-16(18-13-7-3-1-4-8-13)17-11-14-12-21(20-19-14)15-9-5-2-6-10-15/h2-3,5-7,9-10,12-13H,1,4,8,11H2,(H2,17,18,22)/t13-/m1/s1 |
| InChIKey | RIZMNLIKSBGQEB-CYBMUJFWSA-N |
| XLogP | 2.18 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|