About (1S)-N-(1-benzothiophen-2-ylmethyl)-1-(3,5-dimethyl-1,2-oxazol-4-yl)ethanamine
(1S)-N-(1-benzothiophen-2-ylmethyl)-1-(3,5-dimethyl-1,2-oxazol-4-yl)ethanamine (PubChem CID 97224314) has the molecular formula C16H18N2OS
and a molecular weight of 286.40 g/mol. Its IUPAC name is (1S)-N-(1-benzothiophen-2-ylmethyl)-1-(3,5-dimethyl-1,2-oxazol-4-yl)ethanamine.
Molecular Properties
| Compound Name | (1S)-N-(1-benzothiophen-2-ylmethyl)-1-(3,5-dimethyl-1,2-oxazol-4-yl)ethanamine |
| PubChem CID | 97224314 |
| Molecular Formula | C16H18N2OS |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | (1S)-N-(1-benzothiophen-2-ylmethyl)-1-(3,5-dimethyl-1,2-oxazol-4-yl)ethanamine |
| SMILES | Cc1noc(C)c1[C@H](C)NCc1cc2ccccc2s1 |
| InChI | InChI=1S/C16H18N2OS/c1-10(16-11(2)18-19-12(16)3)17-9-14-8-13-6-4-5-7-15(13)20-14/h4-8,10,17H,9H2,1-3H3/t10-/m0/s1 |
| InChIKey | ICBSRZAYAKNCHD-JTQLQIEISA-N |
| XLogP | 4.36 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1S)-N-(1-benzothiophen-2-ylmethyl)-1-(3,5-dimethyl-1,2-oxazol-4-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-N-(1-benzothiophen-2-ylmethyl)-1-(3,5-dimethyl-1,2-oxazol-4-yl)ethanamine?
The IUPAC name of (1S)-N-(1-benzothiophen-2-ylmethyl)-1-(3,5-dimethyl-1,2-oxazol-4-yl)ethanamine (CID 97224314) is (1S)-N-(1-benzothiophen-2-ylmethyl)-1-(3,5-dimethyl-1,2-oxazol-4-yl)ethanamine.
What is the SMILES notation for (1S)-N-(1-benzothiophen-2-ylmethyl)-1-(3,5-dimethyl-1,2-oxazol-4-yl)ethanamine?
The canonical SMILES for (1S)-N-(1-benzothiophen-2-ylmethyl)-1-(3,5-dimethyl-1,2-oxazol-4-yl)ethanamine is Cc1noc(C)c1[C@H](C)NCc1cc2ccccc2s1.
What is the InChIKey of (1S)-N-(1-benzothiophen-2-ylmethyl)-1-(3,5-dimethyl-1,2-oxazol-4-yl)ethanamine?
The InChIKey is ICBSRZAYAKNCHD-JTQLQIEISA-N. The full InChI is InChI=1S/C16H18N2OS/c1-10(16-11(2)18-19-12(16)3)17-9-14-8-13-6-4-5-7-15(13)20-14/h4-8,10,17H,9H2,1-3H3/t10-/m0/s1.
What are the key properties of (1S)-N-(1-benzothiophen-2-ylmethyl)-1-(3,5-dimethyl-1,2-oxazol-4-yl)ethanamine?
(1S)-N-(1-benzothiophen-2-ylmethyl)-1-(3,5-dimethyl-1,2-oxazol-4-yl)ethanamine has a molecular weight of 286.40 g/mol, XLogP of 4.36, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-N-(1-benzothiophen-2-ylmethyl)-1-(3,5-dimethyl-1,2-oxazol-4-yl)ethanamine is sourced from PubChem (CID 97224314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).