C17H25N3O2 — CID 97224996
(1S)-1-(furan-2-yl)-2-[(2R)-1-[(1-methylpyrazol-4-yl)methyl]azepan-2-yl]ethanol (PubChem CID 97224996) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is (1S)-1-(furan-2-yl)-2-[(2R)-1-[(1-methylpyrazol-4-yl)methyl]azepan-2-yl]ethanol.
| Compound Name | (1S)-1-(furan-2-yl)-2-[(2R)-1-[(1-methylpyrazol-4-yl)methyl]azepan-2-yl]ethanol |
|---|---|
| PubChem CID | 97224996 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | (1S)-1-(furan-2-yl)-2-[(2R)-1-[(1-methylpyrazol-4-yl)methyl]azepan-2-yl]ethanol |
| SMILES | Cn1cc(CN2CCCCC[C@@H]2C[C@H](O)c2ccco2)cn1 |
| InChI | InChI=1S/C17H25N3O2/c1-19-12-14(11-18-19)13-20-8-4-2-3-6-15(20)10-16(21)17-7-5-9-22-17/h5,7,9,11-12,15-16,21H,2-4,6,8,10,13H2,1H3/t15-,16+/m1/s1 |
| InChIKey | ZHAVAMIIMOTLAR-CVEARBPZSA-N |
| XLogP | 2.88 |
| TPSA | 54.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |