About 3,5-dimethyl-4-[[(R)-[(1S)-1-(1-phenyltriazol-4-yl)ethyl]sulfinyl]methyl]-1,2-oxazole
3,5-dimethyl-4-[[(R)-[(1S)-1-(1-phenyltriazol-4-yl)ethyl]sulfinyl]methyl]-1,2-oxazole (PubChem CID 97225951) has the molecular formula C16H18N4O2S
and a molecular weight of 330.41 g/mol. Its IUPAC name is 3,5-dimethyl-4-[[(R)-[(1S)-1-(1-phenyltriazol-4-yl)ethyl]sulfinyl]methyl]-1,2-oxazole.
Molecular Properties
| Compound Name | 3,5-dimethyl-4-[[(R)-[(1S)-1-(1-phenyltriazol-4-yl)ethyl]sulfinyl]methyl]-1,2-oxazole |
| PubChem CID | 97225951 |
| Molecular Formula | C16H18N4O2S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 3,5-dimethyl-4-[[(R)-[(1S)-1-(1-phenyltriazol-4-yl)ethyl]sulfinyl]methyl]-1,2-oxazole |
| SMILES | Cc1noc(C)c1C[S@@](=O)[C@@H](C)c1cn(-c2ccccc2)nn1 |
| InChI | InChI=1S/C16H18N4O2S/c1-11-15(12(2)22-18-11)10-23(21)13(3)16-9-20(19-17-16)14-7-5-4-6-8-14/h4-9,13H,10H2,1-3H3/t13-,23+/m0/s1 |
| InChIKey | GQXIVEJOMNARLE-ZAMGYDSWSA-N |
| XLogP | 2.88 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3,5-dimethyl-4-[[(R)-[(1S)-1-(1-phenyltriazol-4-yl)ethyl]sulfinyl]methyl]-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-4-[[(R)-[(1S)-1-(1-phenyltriazol-4-yl)ethyl]sulfinyl]methyl]-1,2-oxazole?
The IUPAC name of 3,5-dimethyl-4-[[(R)-[(1S)-1-(1-phenyltriazol-4-yl)ethyl]sulfinyl]methyl]-1,2-oxazole (CID 97225951) is 3,5-dimethyl-4-[[(R)-[(1S)-1-(1-phenyltriazol-4-yl)ethyl]sulfinyl]methyl]-1,2-oxazole.
What is the SMILES notation for 3,5-dimethyl-4-[[(R)-[(1S)-1-(1-phenyltriazol-4-yl)ethyl]sulfinyl]methyl]-1,2-oxazole?
The canonical SMILES for 3,5-dimethyl-4-[[(R)-[(1S)-1-(1-phenyltriazol-4-yl)ethyl]sulfinyl]methyl]-1,2-oxazole is Cc1noc(C)c1C[S@@](=O)[C@@H](C)c1cn(-c2ccccc2)nn1.
What is the InChIKey of 3,5-dimethyl-4-[[(R)-[(1S)-1-(1-phenyltriazol-4-yl)ethyl]sulfinyl]methyl]-1,2-oxazole?
The InChIKey is GQXIVEJOMNARLE-ZAMGYDSWSA-N. The full InChI is InChI=1S/C16H18N4O2S/c1-11-15(12(2)22-18-11)10-23(21)13(3)16-9-20(19-17-16)14-7-5-4-6-8-14/h4-9,13H,10H2,1-3H3/t13-,23+/m0/s1.
What are the key properties of 3,5-dimethyl-4-[[(R)-[(1S)-1-(1-phenyltriazol-4-yl)ethyl]sulfinyl]methyl]-1,2-oxazole?
3,5-dimethyl-4-[[(R)-[(1S)-1-(1-phenyltriazol-4-yl)ethyl]sulfinyl]methyl]-1,2-oxazole has a molecular weight of 330.41 g/mol, XLogP of 2.88, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-4-[[(R)-[(1S)-1-(1-phenyltriazol-4-yl)ethyl]sulfinyl]methyl]-1,2-oxazole is sourced from PubChem (CID 97225951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).