C19H20N2O2 — CID 97228097
N-[(2R,4R)-4-hydroxy-4-phenylbutan-2-yl]-1H-indole-7-carboxamide (PubChem CID 97228097) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is N-[(2R,4R)-4-hydroxy-4-phenylbutan-2-yl]-1H-indole-7-carboxamide.
| Compound Name | N-[(2R,4R)-4-hydroxy-4-phenylbutan-2-yl]-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 97228097 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | N-[(2R,4R)-4-hydroxy-4-phenylbutan-2-yl]-1H-indole-7-carboxamide |
| SMILES | C[C@H](C[C@@H](O)c1ccccc1)NC(=O)c1cccc2cc[nH]c12 |
| InChI | InChI=1S/C19H20N2O2/c1-13(12-17(22)14-6-3-2-4-7-14)21-19(23)16-9-5-8-15-10-11-20-18(15)16/h2-11,13,17,20,22H,12H2,1H3,(H,21,23)/t13-,17-/m1/s1 |
| InChIKey | SNCKKDVYDGNLSP-CXAGYDPISA-N |
| XLogP | 3.41 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |