C17H24N2O2S — CID 97228273
N-[(3R)-1-[2-[(1R)-1-phenylethyl]sulfanylacetyl]piperidin-3-yl]acetamide (PubChem CID 97228273) has the molecular formula C17H24N2O2S and a molecular weight of 320.46 g/mol. Its IUPAC name is N-[(3R)-1-[2-[(1R)-1-phenylethyl]sulfanylacetyl]piperidin-3-yl]acetamide.
| Compound Name | N-[(3R)-1-[2-[(1R)-1-phenylethyl]sulfanylacetyl]piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 97228273 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | N-[(3R)-1-[2-[(1R)-1-phenylethyl]sulfanylacetyl]piperidin-3-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1CCCN(C(=O)CS[C@H](C)c2ccccc2)C1 |
| InChI | InChI=1S/C17H24N2O2S/c1-13(15-7-4-3-5-8-15)22-12-17(21)19-10-6-9-16(11-19)18-14(2)20/h3-5,7-8,13,16H,6,9-12H2,1-2H3,(H,18,20)/t13-,16-/m1/s1 |
| InChIKey | GEPIBPIRIJTICV-CZUORRHYSA-N |
| XLogP | 2.61 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |