C20H28N2O3 — CID 97228633
1-(2-ethoxyethyl)-N-[[(4R)-2-oxo-3,4-dihydro-1H-quinolin-4-yl]methyl]cyclopentane-1-carboxamide (PubChem CID 97228633) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-N-[[(4R)-2-oxo-3,4-dihydro-1H-quinolin-4-yl]methyl]cyclopentane-1-carboxamide.
| Compound Name | 1-(2-ethoxyethyl)-N-[[(4R)-2-oxo-3,4-dihydro-1H-quinolin-4-yl]methyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 97228633 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 1-(2-ethoxyethyl)-N-[[(4R)-2-oxo-3,4-dihydro-1H-quinolin-4-yl]methyl]cyclopentane-1-carboxamide |
| SMILES | CCOCCC1(C(=O)NC[C@@H]2CC(=O)Nc3ccccc32)CCCC1 |
| InChI | InChI=1S/C20H28N2O3/c1-2-25-12-11-20(9-5-6-10-20)19(24)21-14-15-13-18(23)22-17-8-4-3-7-16(15)17/h3-4,7-8,15H,2,5-6,9-14H2,1H3,(H,21,24)(H,22,23)/t15-/m0/s1 |
| InChIKey | YXSIPLFDYPBESM-HNNXBMFYSA-N |
| XLogP | 3.22 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|